CAS 6942-37-6 appears in our catalog under these names: Methyl 5–amino–2–bromobenzoate, Methyl 5-Amino-2-bromobenzoate, 95%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g, 10g.
Methyl 5-amino-2-bromobenzoate (CAS 6942-37-6) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 5-amino-2-bromobenzoate. InChIKey: OFDWPQOLEQDJIX-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 5-amino-2-bromobenzoate |
| InChIKey | OFDWPQOLEQDJIX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)Br |
Computed by PubChem (NCBI)