Products 694436-84-5
CAS 694436-84-5 is the registry number for N-(4-Cyanophenyl)cyclobutanecarboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-cyanophenyl)cyclobutanecarboxamide (CAS 694436-84-5) is a chemical compound with the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. IUPAC name: N-(4-cyanophenyl)cyclobutanecarboxamide. InChIKey: SWUKTBKBZCWFFA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | N-(4-cyanophenyl)cyclobutanecarboxamide |
| InChIKey | SWUKTBKBZCWFFA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C(=O)NC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)