Products 69480-03-1
CAS 69480-03-1 is the registry number for 2-Methyl-4-isobutyrylphloroglucinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)propan-1-one (CAS 69480-03-1) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)propan-1-one. InChIKey: VZGICEILONCHRY-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-methyl-1-(2,4,6-trihydroxy-3-methylphenyl)propan-1-one |
| InChIKey | VZGICEILONCHRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1O)O)C(=O)C(C)C)O |
Computed by PubChem (NCBI)