CAS 695187-10-1 appears in our catalog under these names: Ethyl 3-Chloro4-fluorocinnamate, 95%, (2E)-3-(3-CHloro-4-fluorophenyl)-2-propenoic acid, ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (CAS 695187-10-1) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: ethyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate. InChIKey: JEXAHVAICWOJHJ-GQCTYLIASA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | ethyl (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| InChIKey | JEXAHVAICWOJHJ-GQCTYLIASA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)