CAS 1511861-89-4 appears in our catalog under these names: 2-(4-Chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid, 2-(4-Chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
2-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid (CAS 1511861-89-4) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: 2-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: RUSMVFLKTIIRDG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 2-(4-chloro-2-fluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | RUSMVFLKTIIRDG-UHFFFAOYSA-N |
| SMILES | C1CC(C1C2=C(C=C(C=C2)Cl)F)C(=O)O |
Computed by PubChem (NCBI)