CAS 943126-72-5 appears in our catalog under these names: Nebivolol Impurity 101, 2-Chloro-1-(6-fluoro-3,4-dihydro-1-benzopyran-2-yl)ethanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone (CAS 943126-72-5) is a chemical compound with the molecular formula C11H10ClFO2 and a molecular weight of 228.65 g/mol. IUPAC name: 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone. InChIKey: JOIVVMUMDLHKRF-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO2 |
|---|---|
| Molecular weight | 228.65 g/mol |
| IUPAC name | 2-chloro-1-(6-fluoro-3,4-dihydro-2H-chromen-2-yl)ethanone |
| InChIKey | JOIVVMUMDLHKRF-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1C(=O)CCl |
Computed by PubChem (NCBI)