CAS 6955-30-2 is the registry number for 3-Benzylaniline hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-benzylaniline (CAS 6955-30-2) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 3-benzylaniline. InChIKey: GZYMMTQDXHJALZ-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 3-benzylaniline |
| InChIKey | GZYMMTQDXHJALZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CC=C2)N |
Computed by PubChem (NCBI)