CAS 6957-19-3 appears in our catalog under these names: 2,3,6,7-Tetramethylquinoxaline, 95-<97%, Iodoquinol Impurity 11. Offered by: Hoffman Fine Chemicals, Hubei YoungXin. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g, 10mg, 25mg.
2,3,6,7-tetramethylquinoxaline (CAS 6957-19-3) is a chemical compound with the molecular formula C12H14N2 and a molecular weight of 186.25 g/mol. IUPAC name: 2,3,6,7-tetramethylquinoxaline. InChIKey: MRHHHYZFDDQAQL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2 |
|---|---|
| Molecular weight | 186.25 g/mol |
| IUPAC name | 2,3,6,7-tetramethylquinoxaline |
| InChIKey | MRHHHYZFDDQAQL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N=C2C=C1C)C)C |
Computed by PubChem (NCBI)