CAS 6962-62-5 is the registry number for 2',4'-Dihydroxy-3,4-methylenedioxychalcone. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg.
(E)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxyphenyl)prop-2-en-1-one (CAS 6962-62-5) is a chemical compound with the molecular formula C16H12O5 and a molecular weight of 284.26 g/mol. IUPAC name: (E)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxyphenyl)prop-2-en-1-one. InChIKey: SQQNYFMYKXCRKD-ORCRQEGFSA-N.
| Molecular formula | C16H12O5 |
|---|---|
| Molecular weight | 284.26 g/mol |
| IUPAC name | (E)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| InChIKey | SQQNYFMYKXCRKD-ORCRQEGFSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)