CAS 6965-39-5 is the registry number for 2-(4-Chlorophenyl)-N'-hydroxyethanimidamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(4-chlorophenyl)-N'-hydroxyethanimidamide (CAS 6965-39-5) is a chemical compound with the molecular formula C8H9ClN2O and a molecular weight of 184.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-N'-hydroxyethanimidamide. InChIKey: MLNLOCIMTRRCHX-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O |
|---|---|
| Molecular weight | 184.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-N'-hydroxyethanimidamide |
| InChIKey | MLNLOCIMTRRCHX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C/C(=N/O)/N)Cl |
Computed by PubChem (NCBI)