Products 696637-93-1

CAS 696637-93-1 is the registry number for (3-Methyl-2-oxo-3,4-dihydroquinazolin-1(2h)-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(3-methyl-2-oxo-4H-quinazolin-1-yl)acetic acid (CAS 696637-93-1) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 2-(3-methyl-2-oxo-4H-quinazolin-1-yl)acetic acid. InChIKey: YYGSYXAQZZTYJV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O3
Molecular weight220.22 g/mol
IUPAC name2-(3-methyl-2-oxo-4H-quinazolin-1-yl)acetic acid
InChIKeyYYGSYXAQZZTYJV-UHFFFAOYSA-N
SMILESCN1CC2=CC=CC=C2N(C1=O)CC(=O)O

Computed by PubChem (NCBI)