CAS 696656-68-5 is the registry number for 6-Hydroxy-2-phenyldihydro-1h,5h-pyrazolo[1,2-a][1,2,4]triazole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-hydroxy-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione (CAS 696656-68-5) is a chemical compound with the molecular formula C11H11N3O3 and a molecular weight of 233.22 g/mol. IUPAC name: 6-hydroxy-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione. InChIKey: YNDWYHLIHMAPKP-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 6-hydroxy-2-phenyl-6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazole-1,3-dione |
| InChIKey | YNDWYHLIHMAPKP-UHFFFAOYSA-N |
| SMILES | C1C(CN2N1C(=O)N(C2=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)