CAS 697260-51-8 is the registry number for Isoquinine. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg.
(R)-[(2S,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 697260-51-8) is a chemical compound with the molecular formula C20H24N2O2 and a molecular weight of 324.4 g/mol. IUPAC name: (R)-[(2S,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: DTEXULLZKFAGHZ-FOFNQSGBSA-N.
| Molecular formula | C20H24N2O2 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | (R)-[(2S,5Z)-5-ethylidene-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | DTEXULLZKFAGHZ-FOFNQSGBSA-N |
| SMILES | C/C=C/1\CN2CCC1C[C@H]2[C@@H](C3=C4C=C(C=CC4=NC=C3)OC)O |
Computed by PubChem (NCBI)