CAS 69740-86-9 is the registry number for 5-Ethyl-2-hydroxyisophthalaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethyl-2-hydroxybenzene-1,3-dicarbaldehyde (CAS 69740-86-9) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 5-ethyl-2-hydroxybenzene-1,3-dicarbaldehyde. InChIKey: XIIDEQJBJLXAHY-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 5-ethyl-2-hydroxybenzene-1,3-dicarbaldehyde |
| InChIKey | XIIDEQJBJLXAHY-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C(=C1)C=O)O)C=O |
Computed by PubChem (NCBI)