CAS 697738-99-1 appears in our catalog under these names: 5-Amino-1-methyl-1,2-dihydroquinolin-2-one, 5-Amino-1-methyl-1,2-dihydroquinolin-2-one, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
5-amino-1-methylquinolin-2-one (CAS 697738-99-1) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 5-amino-1-methylquinolin-2-one. InChIKey: XUNJKWXYQMKWHJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 5-amino-1-methylquinolin-2-one |
| InChIKey | XUNJKWXYQMKWHJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C=CC2=C(C=CC=C21)N |
Computed by PubChem (NCBI)