Products 697765-49-4
CAS 697765-49-4 appears in our catalog under these names: Poly(tert-Butyl Acrylate)-block-Poly(styrene) (Copolymer, 10:6), Poly(tert-Butyl Acrylate)-block-Poly(styrene) (Copolymer, 10:11), Poly(tert-Butyl Acrylate)-block-Poly(styrene) (Copolymer, 10:25), 2-Propenoic acid, 1,1-dimethylethyl ester, polymer with ethenylbenzene, diblock. Offered by: TCI, Chemat. Available pack sizes: 200mg, 25mg.
Tert-butyl prop-2-enoate;styrene (CAS 697765-49-4) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: tert-butyl prop-2-enoate;styrene. InChIKey: SCOXLWGZJOJOTP-UHFFFAOYSA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | tert-butyl prop-2-enoate;styrene |
| InChIKey | SCOXLWGZJOJOTP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C=C.C=CC1=CC=CC=C1 |
Computed by PubChem (NCBI)