CAS 69875-15-6 appears in our catalog under these names: N-(L-Alanyl)-N-methylglycine, 98%, H-Ala-Sar-OH 95%. Offered by: Chemat Brand, Ambeed. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 1g.
2-[[(2S)-2-aminopropanoyl]-methylamino]acetic acid (CAS 69875-15-6) is a chemical compound with the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. IUPAC name: 2-[[(2S)-2-aminopropanoyl]-methylamino]acetic acid. InChIKey: ZDRWFRSNOABMAL-BYPYZUCNSA-N.
| Molecular formula | C6H12N2O3 |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 2-[[(2S)-2-aminopropanoyl]-methylamino]acetic acid |
| InChIKey | ZDRWFRSNOABMAL-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(=O)N(C)CC(=O)O)N |
Computed by PubChem (NCBI)