CAS 69904-14-9 is the registry number for 6-Amino-7-methyl-2,3-quinoxalinediol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-amino-7-methyl-1,4-dihydroquinoxaline-2,3-dione (CAS 69904-14-9) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 6-amino-7-methyl-1,4-dihydroquinoxaline-2,3-dione. InChIKey: FWTQHXAYMVYHKX-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 6-amino-7-methyl-1,4-dihydroquinoxaline-2,3-dione |
| InChIKey | FWTQHXAYMVYHKX-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)NC(=O)C(=O)N2 |
Computed by PubChem (NCBI)