CAS 69980-45-6 is the registry number for alpha-Hydroxymethyl-L-tyrosine. Offered by: TRC. Available pack sizes: 500mg.
(2R)-2-amino-2-(hydroxymethyl)-3-(4-hydroxyphenyl)propanoic acid (CAS 69980-45-6) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: (2R)-2-amino-2-(hydroxymethyl)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: KQAABALABGCGPM-SNVBAGLBSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | (2R)-2-amino-2-(hydroxymethyl)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | KQAABALABGCGPM-SNVBAGLBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@](CO)(C(=O)O)N)O |
Computed by PubChem (NCBI)