CAS 69998-54-5 is the registry number for Methylbarbital-d5. Offered by: TRC. Available pack sizes: 25mg.
5-ethyl-1-methyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione (CAS 69998-54-5) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 203.25 g/mol. IUPAC name: 5-ethyl-1-methyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione. InChIKey: FWJKNZONDWOGMI-SGEUAGPISA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 203.25 g/mol |
| IUPAC name | 5-ethyl-1-methyl-5-(1,1,2,2,2-pentadeuterioethyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | FWJKNZONDWOGMI-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=O)N(C1=O)C)CC |
Computed by PubChem (NCBI)