Products 70-38-2
CAS 70-38-2 is the registry number for Dimethrin. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 10 mg, 50 mg, 100 mg.
(2,4-dimethylphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (CAS 70-38-2) is a chemical compound with the molecular formula C19H26O2 and a molecular weight of 286.4 g/mol. IUPAC name: (2,4-dimethylphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate. InChIKey: FHNKBSDJERHDHZ-UHFFFAOYSA-N.
| Molecular formula | C19H26O2 |
|---|---|
| Molecular weight | 286.4 g/mol |
| IUPAC name | (2,4-dimethylphenyl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| InChIKey | FHNKBSDJERHDHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)COC(=O)C2C(C2(C)C)C=C(C)C)C |
Computed by PubChem (NCBI)
Synonyms:
DIMETHRIN, Dimetrin, Dimethrine, Caswell No. 359, 2,4-Dimethylbenzyl chrysanthemumate, 2,4-Dimethylbenzyl 2,2-dimethyl-3-(2-methylpropenyl)cyclopropanecarboxylate, 2,4-Dimethylbenzyl-(I)-cis-trans-chrysanthemumate, 2,4-Dimethylbenzyl ester of cis,trans-chrysanthemumic acid, Chrysanthemumic acid 2,4-dimethylbenzyl ester, 2,4-Dimethylbenzylester kyseliny chrysanthemove