Products 70116-00-6
CAS 70116-00-6 appears in our catalog under these names: Quinidine N-Oxide, Quinidine N–oxide. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 500μg, 1 mg.
(S)-[(1R,2R,4S,5R)-5-ethenyl-1-oxido-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol (CAS 70116-00-6) is a chemical compound with the molecular formula C20H24N2O3 and a molecular weight of 340.4 g/mol. IUPAC name: (S)-[(1R,2R,4S,5R)-5-ethenyl-1-oxido-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol. InChIKey: WVDIZKMXQMCCAA-ROCUERRRSA-N.
| Molecular formula | C20H24N2O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | (S)-[(1R,2R,4S,5R)-5-ethenyl-1-oxido-1-azoniabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol |
| InChIKey | WVDIZKMXQMCCAA-ROCUERRRSA-N |
| SMILES | COC1=CC2=C(C=CN=C2C=C1)[C@@H]([C@H]3C[C@@H]4CC[N@+]3(C[C@@H]4C=C)[O-])O |
Computed by PubChem (NCBI)