CAS 70132-79-5 appears in our catalog under these names: (2-Chlorophenyl)(2,5-dimethylphenyl)methanone, 95%, (2-Chlorophenyl)(2,5-dimethylphenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(2-chlorophenyl)-(2,5-dimethylphenyl)methanone (CAS 70132-79-5) is a chemical compound with the molecular formula C15H13ClO and a molecular weight of 244.71 g/mol. IUPAC name: (2-chlorophenyl)-(2,5-dimethylphenyl)methanone. InChIKey: JUVLZKBPCAPPMA-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO |
|---|---|
| Molecular weight | 244.71 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,5-dimethylphenyl)methanone |
| InChIKey | JUVLZKBPCAPPMA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C(=O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)