CAS 70261-49-3 appears in our catalog under these names: 2,4-Dimethyl-3-nitrophenol, 2,4-Dimethyl-3-nitrophenol 98%, 2,4-Dimethyl-3-nitrophenol, 98%, 2,4-Dimethyl-3-nitrophenol, 98%, 98%. Offered by: TRC, Ambeed, Fluorochem, Chemat. Available pack sizes: 750mg, 100mg, 250mg, 1g, 5g, 10g, 25g.
2,4-dimethyl-3-nitrophenol (CAS 70261-49-3) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,4-dimethyl-3-nitrophenol. InChIKey: PBXYRJKKBWMVSG-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,4-dimethyl-3-nitrophenol |
| InChIKey | PBXYRJKKBWMVSG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)O)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)