CAS 70261-50-6 appears in our catalog under these names: 2,6-Dimethyl-3-(phenylmethoxy)-aniline, 3-(Benzyloxy)-2,6-dimethylaniline, 3-(Benzyloxy)-2,6-dimethylaniline, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 500mg, 50mg, 0,5g, 100mg, 250mg, 1g.
2,6-dimethyl-3-phenylmethoxyaniline (CAS 70261-50-6) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: 2,6-dimethyl-3-phenylmethoxyaniline. InChIKey: KMXQUVMDZUGZIA-UHFFFAOYSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | 2,6-dimethyl-3-phenylmethoxyaniline |
| InChIKey | KMXQUVMDZUGZIA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)OCC2=CC=CC=C2)C)N |
Computed by PubChem (NCBI)