Products 70310-73-5
CAS 70310-73-5 appears in our catalog under these names: (-)-Eseroline Fumarate Salt, >95% (HPLC), (-)-Eseroline fumarate, (-)-Eseroline (fumarate). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 2mg, 1mg, 10mg, 5 mg, 50 mg.
(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol;(E)-but-2-enedioic acid (CAS 70310-73-5) is a chemical compound with the molecular formula C17H22N2O5 and a molecular weight of 334.4 g/mol. IUPAC name: (3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol;(E)-but-2-enedioic acid. InChIKey: PBZRRADJWNBPNY-XDRMOJKASA-N.
| Molecular formula | C17H22N2O5 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | (3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-ol;(E)-but-2-enedioic acid |
| InChIKey | PBZRRADJWNBPNY-XDRMOJKASA-N |
| SMILES | C[C@@]12CCN([C@@H]1N(C3=C2C=C(C=C3)O)C)C.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)