CAS 70389-96-7 is the registry number for 4(15),11-Oppositadien-1-ol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, Get quote.
(1R,3aR,4R,7aS)-3a-methyl-7-methylidene-1-(2-methylprop-2-enyl)-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol (CAS 70389-96-7) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: (1R,3aR,4R,7aS)-3a-methyl-7-methylidene-1-(2-methylprop-2-enyl)-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol. InChIKey: HLVNRJLLBUWVCO-TUVASFSCSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | (1R,3aR,4R,7aS)-3a-methyl-7-methylidene-1-(2-methylprop-2-enyl)-2,3,4,5,6,7a-hexahydro-1H-inden-4-ol |
| InChIKey | HLVNRJLLBUWVCO-TUVASFSCSA-N |
| SMILES | CC(=C)C[C@H]1CC[C@@]2([C@@H]1C(=C)CC[C@H]2O)C |
Computed by PubChem (NCBI)