CAS 704-14-3 appears in our catalog under these names: 5-Methoxy-2-nitrophenol, 5-Methoxy-2-nitrophenol, 98%, 5-Methoxy-2-nitrophenol 97%, 5-Methoxy-2-nitrophenol, 97%, 97%, 5-Methoxy-2-nitrophenol, 95%. Offered by: TRC, Biosynth, Thermo Scientific (Acros), Ambeed, Chemat. Available pack sizes: 1g, 2,5g, 500mg, 25g, 50g, 5g, 100g, 250g.
5-methoxy-2-nitrophenol (CAS 704-14-3) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 5-methoxy-2-nitrophenol. InChIKey: NRTULWPODYLFOJ-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5-methoxy-2-nitrophenol |
| InChIKey | NRTULWPODYLFOJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)