Products 704-91-6
CAS 704-91-6 appears in our catalog under these names: 1H-Indazole-6-carboxylic acid, 97%, 2H-Indazole-6-carboxylic acid, 95%, 1H-Indazole-6-carboxylic acid, 98+%, 1H-Indazole-6-carboxylic acid, 98%, 1H-Indazole-6-carboxylic acid, 95%. Offered by: Combi-blocks, Thermo Scientific (Acros), Ambeed, BLDpharm, Fluorochem. Available pack sizes: 25g, 10g, 100g, 5g, 1g, 250mg, 15g, 75g.
1H-indazole-6-carboxylic acid (CAS 704-91-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-indazole-6-carboxylic acid. InChIKey: DNCVTVVLMRHJCJ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-indazole-6-carboxylic acid |
| InChIKey | DNCVTVVLMRHJCJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NN=C2 |
Computed by PubChem (NCBI)