CAS 70401-32-0 appears in our catalog under these names: Carbamazepine Impurity 10 (2-Methyl Carbamazepine), Carbamazepine Impurity 13. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-methylbenzo[b][1]benzazepine-11-carboxamide (CAS 70401-32-0) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 250.29 g/mol. IUPAC name: 3-methylbenzo[b][1]benzazepine-11-carboxamide. InChIKey: WLUGVRXHDCWYLA-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-methylbenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | WLUGVRXHDCWYLA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C3=CC=CC=C3C=C2)C(=O)N |
Computed by PubChem (NCBI)