Products 7042-36-6
CAS 7042-36-6 is the registry number for (E)-tert-Butyl 3-phenylacrylate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Tert-butyl (E)-3-phenylprop-2-enoate (CAS 7042-36-6) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: tert-butyl (E)-3-phenylprop-2-enoate. InChIKey: AGKLVMVJXDFIGC-MDZDMXLPSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | tert-butyl (E)-3-phenylprop-2-enoate |
| InChIKey | AGKLVMVJXDFIGC-MDZDMXLPSA-N |
| SMILES | CC(C)(C)OC(=O)/C=C/C1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
(E)-tert-Butyl 3-phenylacrylate, tert-butyl (E)-3-phenylprop-2-enoate, tert-butylcinnamate, 3-phenyl-acrylic acid tert-butyl ester, 2-Propenoic acid, 3-phenyl-, 1,1-dimethylethyl ester, (E)-, tert-Butyl 3-phenylacrylate, t-butyl cinnamate, 2-Propenoic acid, 3-phenyl-, 1,1-dimethylethyl ester, tert-butyl (2E)-3-phenylprop-2-enoate, tert-Butyl cinnamate, 98%