CAS 70442-25-0 appears in our catalog under these names: D-Mannose 6-phosphate sodium salt, 95%, D-Mannose-6-phosphate Sodium Salt, >95% (HPLC), Sodium (2R,3R,4S,5S)–2,3,4,5–tetrahydroxy–6–oxohexyl hydrogenphosphate, D-Mannose-6-phosphate sodium, D-Mannose 6-Phosphate Sodium Salt, ≥95%, ≥95%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 10mg, 50mg, 5mg, 1000mg, 500mg.
Sodium [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate (CAS 70442-25-0) is a chemical compound with the molecular formula C6H12NaO9P and a molecular weight of 282.12 g/mol. IUPAC name: sodium [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate. InChIKey: OBHLNVXMRZXIII-MVNLRXSJSA-M.
| Molecular formula | C6H12NaO9P |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | sodium [(2R,3R,4S,5S)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate |
| InChIKey | OBHLNVXMRZXIII-MVNLRXSJSA-M |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)O)O)O)O)OP(=O)(O)[O-].[Na+] |
Computed by PubChem (NCBI)