CAS 84332-92-3 is the registry number for beta-D-Glucose 6-phosphate sodium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
Sodium (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(phosphonooxymethyl)oxan-2-olate (CAS 84332-92-3) is a chemical compound with the molecular formula C6H12NaO9P and a molecular weight of 282.12 g/mol. IUPAC name: sodium (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(phosphonooxymethyl)oxan-2-olate. InChIKey: OGJCEWUZHUPSJH-WYRLRVFGSA-N.
| Molecular formula | C6H12NaO9P |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | sodium (2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(phosphonooxymethyl)oxan-2-olate |
| InChIKey | OGJCEWUZHUPSJH-WYRLRVFGSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)[O-])O)O)O)OP(=O)(O)O.[Na+] |
Computed by PubChem (NCBI)