CAS 99749-54-9 appears in our catalog under these names: alpha-D-Mannopyranosyl Phosphate Disodium, a–D–Mannose–1–phosphate sodium salt, α-D-Mannose-1-phosphate sodium, α-D-Mannopyranosyl phosphate disodium salt, α-D-Mannose-1-phosphate sodium, 10 mg. Offered by: TRC, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 25mg, 2mg, 5mg, 100mg, 10mg, 50mg.
Sodium [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate (CAS 99749-54-9) is a chemical compound with the molecular formula C6H12NaO9P and a molecular weight of 282.12 g/mol. IUPAC name: sodium [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate. InChIKey: YSLVOZPKBHMBRV-GDTYSWHPSA-M.
| Molecular formula | C6H12NaO9P |
|---|---|
| Molecular weight | 282.12 g/mol |
| IUPAC name | sodium [(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| InChIKey | YSLVOZPKBHMBRV-GDTYSWHPSA-M |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OP(=O)(O)[O-])O)O)O)O.[Na+] |
Computed by PubChem (NCBI)