Products 70442-47-6

CAS 70442-47-6 is the registry number for 4-(2,4-Dimethylphenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-(2,4-dimethylphenoxy)butanoic acid (CAS 70442-47-6) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 4-(2,4-dimethylphenoxy)butanoic acid. InChIKey: OLCDCKDJWZYWDM-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16O3
Molecular weight208.25 g/mol
IUPAC name4-(2,4-dimethylphenoxy)butanoic acid
InChIKeyOLCDCKDJWZYWDM-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)OCCCC(=O)O)C

Computed by PubChem (NCBI)