CAS 705-23-7 appears in our catalog under these names: 2-(tert-Butyl)-4,6-dichloro-1,3,5-triazine, 95-<97%, 2-(Tert-butyl)-4,6-dichloro-1,3,5-triazine, 97%, 97%, 2-(tert-Butyl)-4,6-dichloro-1,3,5-triazine, 97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g, 100mg, 250mg.
2-tert-butyl-4,6-dichloro-1,3,5-triazine (CAS 705-23-7) is a chemical compound with the molecular formula C7H9Cl2N3 and a molecular weight of 206.07 g/mol. IUPAC name: 2-tert-butyl-4,6-dichloro-1,3,5-triazine. InChIKey: MKOAJICWQJCFMS-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2N3 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-tert-butyl-4,6-dichloro-1,3,5-triazine |
| InChIKey | MKOAJICWQJCFMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)