Products 70552-70-4

CAS 70552-70-4 is the registry number for 1-Cinnamylpiperidine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

1-(3-phenylprop-2-enyl)piperidine (CAS 70552-70-4) is a chemical compound with the molecular formula C14H19N and a molecular weight of 201.31 g/mol. IUPAC name: 1-(3-phenylprop-2-enyl)piperidine. InChIKey: ZJNARIDKWBUMOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19N
Molecular weight201.31 g/mol
IUPAC name1-(3-phenylprop-2-enyl)piperidine
InChIKeyZJNARIDKWBUMOZ-UHFFFAOYSA-N
SMILESC1CCN(CC1)CC=CC2=CC=CC=C2

Computed by PubChem (NCBI)