CAS 70659-92-6 appears in our catalog under these names: (4-Azidobutoxy)benzene, 98%, 98%, (diazyn-1-ium-1-yl)(4-phenoxybutyl)azanide, 98%, (4-Azidobutoxy)benzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-azidobutoxybenzene (CAS 70659-92-6) is a chemical compound with the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. IUPAC name: 4-azidobutoxybenzene. InChIKey: MPBLZSBUZGDDKT-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 4-azidobutoxybenzene |
| InChIKey | MPBLZSBUZGDDKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)