CAS 706791-83-5 appears in our catalog under these names: Methyl 3-amino-5-bromobenzoate, 95%, Methyl 3-amino-5-bromobenzoate, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
Methyl 3-amino-5-bromobenzoate (CAS 706791-83-5) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: methyl 3-amino-5-bromobenzoate. InChIKey: MNXLJDUZJCMJCI-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | methyl 3-amino-5-bromobenzoate |
| InChIKey | MNXLJDUZJCMJCI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)