CAS 706806-59-9 appears in our catalog under these names: Boc-(s)-alpha-allyl-proline, 95%, (S)-2-Allyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 97%, (S)–2–Allyl–1–(tert–butoxycarbonyl)pyrrolidine–2–carboxylic acid, Boc-(s)-alpha-allyl-proline, 95%, 95%, Boc-(S)-α-allyl-Pro-OH, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enylpyrrolidine-2-carboxylic acid (CAS 706806-59-9) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enylpyrrolidine-2-carboxylic acid. InChIKey: ZTMLHNDSVVOEEH-CYBMUJFWSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2-prop-2-enylpyrrolidine-2-carboxylic acid |
| InChIKey | ZTMLHNDSVVOEEH-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@]1(CC=C)C(=O)O |
Computed by PubChem (NCBI)