Products 70735-86-3
CAS 70735-86-3 is the registry number for 6-(2-Methylpropanoyl)-2,3-dihydro-1,3-benzoxazol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(2-methylpropanoyl)-3H-1,3-benzoxazol-2-one (CAS 70735-86-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 6-(2-methylpropanoyl)-3H-1,3-benzoxazol-2-one. InChIKey: OINVUOULQDNSJV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 6-(2-methylpropanoyl)-3H-1,3-benzoxazol-2-one |
| InChIKey | OINVUOULQDNSJV-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=CC2=C(C=C1)NC(=O)O2 |
Computed by PubChem (NCBI)