CAS 708-74-7 appears in our catalog under these names: Methotrexate Impurity 32, 6-Methylpteridine-2,4-diamine. Offered by: Chemat Brand, Mikromol. Available pack sizes: on request, 25mg.
6-methylpteridine-2,4-diamine (CAS 708-74-7) is a chemical compound with the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. IUPAC name: 6-methylpteridine-2,4-diamine. InChIKey: MFNAKLLYSPINFZ-UHFFFAOYSA-N.
| Molecular formula | C7H8N6 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 6-methylpteridine-2,4-diamine |
| InChIKey | MFNAKLLYSPINFZ-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=N1)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)