Products 944663-31-4
CAS 944663-31-4 is the registry number for 4-(1H-Tetrazol-1-yl)-1,2-benzenediamine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
4-(tetrazol-1-yl)benzene-1,2-diamine (CAS 944663-31-4) is a chemical compound with the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. IUPAC name: 4-(tetrazol-1-yl)benzene-1,2-diamine. InChIKey: GVEGLPUNQUIOEO-UHFFFAOYSA-N.
| Molecular formula | C7H8N6 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 4-(tetrazol-1-yl)benzene-1,2-diamine |
| InChIKey | GVEGLPUNQUIOEO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C=NN=N2)N)N |
Computed by PubChem (NCBI)