CAS 4215-07-0 is the registry number for Methotrexate Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
7-methylpteridine-2,4-diamine (CAS 4215-07-0) is a chemical compound with the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. IUPAC name: 7-methylpteridine-2,4-diamine. InChIKey: CECXILQSXHHKTG-UHFFFAOYSA-N.
| Molecular formula | C7H8N6 |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 7-methylpteridine-2,4-diamine |
| InChIKey | CECXILQSXHHKTG-UHFFFAOYSA-N |
| SMILES | CC1=CN=C2C(=NC(=NC2=N1)N)N |
Computed by PubChem (NCBI)