CAS 708258-27-9 is the registry number for 4-(Dimethyl-1,3-oxazol-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(4,5-dimethyl-1,3-oxazol-2-yl)aniline (CAS 708258-27-9) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 4-(4,5-dimethyl-1,3-oxazol-2-yl)aniline. InChIKey: NBZPXKWVHMSYOR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 4-(4,5-dimethyl-1,3-oxazol-2-yl)aniline |
| InChIKey | NBZPXKWVHMSYOR-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)