Products 70849-31-9
CAS 70849-31-9 appears in our catalog under these names: D-Mannose-1-¹³C, ≥99 atom% 13C,≥99%, ≥99 atom% 13C,≥99%, D-Mannose-13C, 99.90%, D-Mannose-1-¹³C, ≥99 atom% 13C,≥99%, D-mannose-1-13C, 99 atom % 13C. Offered by: Chemat, MedChemExpress, Sigma-Aldrich. Available pack sizes: 500mg, 50 mg, 100 mg, 25 mg, 25mg, 100mg.
(3S,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol (CAS 70849-31-9) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.15 g/mol. IUPAC name: (3S,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-YILIOCFTSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | (3S,4S,5S,6R)-6-(hydroxymethyl)(213C)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-YILIOCFTSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@@H]([13CH](O1)O)O)O)O)O |
Computed by PubChem (NCBI)