Products 70857-56-6

CAS 70857-56-6 is the registry number for Phthalic acid, bis-2-methyloctyl ester. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg.

Structural formula: {0} (CAS {1})

Bis(2-methyloctyl) benzene-1,2-dicarboxylate (CAS 70857-56-6) is a chemical compound with the molecular formula C26H42O4 and a molecular weight of 418.6 g/mol. IUPAC name: bis(2-methyloctyl) benzene-1,2-dicarboxylate. InChIKey: GXRDMEGSBKPONF-UHFFFAOYSA-N.

Identity
Molecular formulaC26H42O4
Molecular weight418.6 g/mol
IUPAC namebis(2-methyloctyl) benzene-1,2-dicarboxylate
InChIKeyGXRDMEGSBKPONF-UHFFFAOYSA-N
SMILESCCCCCCC(C)COC(=O)C1=CC=CC=C1C(=O)OCC(C)CCCCCC

Computed by PubChem (NCBI)