CAS 70894-13-2 appears in our catalog under these names: [1,1'-Biphenyl]-2,2'-diol, 4,4'-diamino-, 97%, 97%, 4,4'-DIAMINOBIPHENYL-2,2'-DIOL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
5-amino-2-(4-amino-2-hydroxyphenyl)phenol (CAS 70894-13-2) is a chemical compound with the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. IUPAC name: 5-amino-2-(4-amino-2-hydroxyphenyl)phenol. InChIKey: YPCNDGPUJSVBIV-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O2 |
|---|---|
| Molecular weight | 216.24 g/mol |
| IUPAC name | 5-amino-2-(4-amino-2-hydroxyphenyl)phenol |
| InChIKey | YPCNDGPUJSVBIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)O)C2=C(C=C(C=C2)N)O |
Computed by PubChem (NCBI)