CAS 710339-49-4 appears in our catalog under these names: Aripiprazole Impurity 25, Milnacipran Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
3H-2-benzofuran-1-ylidene(diethyl)azanium bromide (CAS 710339-49-4) is a chemical compound with the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. IUPAC name: 3H-2-benzofuran-1-ylidene(diethyl)azanium bromide. InChIKey: PFNOEETUEBZYTA-UHFFFAOYSA-M.
| Molecular formula | C12H16BrNO |
|---|---|
| Molecular weight | 270.17 g/mol |
| IUPAC name | 3H-2-benzofuran-1-ylidene(diethyl)azanium bromide |
| InChIKey | PFNOEETUEBZYTA-UHFFFAOYSA-M |
| SMILES | CC[N+](=C1C2=CC=CC=C2CO1)CC.[Br-] |
Computed by PubChem (NCBI)