CAS 710348-89-3 is the registry number for 8-Fluoro-10,11-dihydro-benzo[4,5]cyclohepta[1,2-b]pyridin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one (CAS 710348-89-3) is a chemical compound with the molecular formula C14H10FNO and a molecular weight of 227.23 g/mol. IUPAC name: 13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one. InChIKey: PVYLZBOCBZTZDG-UHFFFAOYSA-N.
| Molecular formula | C14H10FNO |
|---|---|
| Molecular weight | 227.23 g/mol |
| IUPAC name | 13-fluoro-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-one |
| InChIKey | PVYLZBOCBZTZDG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC=N2)C(=O)C3=C1C=C(C=C3)F |
Computed by PubChem (NCBI)